C11H12FNO4 — CID 107013327
4-[(4-fluoro-2-hydroxybenzoyl)amino]butanoic acid (PubChem CID 107013327) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is 4-[(4-fluoro-2-hydroxybenzoyl)amino]butanoic acid.
| Compound Name | 4-[(4-fluoro-2-hydroxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107013327 |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 4-[(4-fluoro-2-hydroxybenzoyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C11H12FNO4/c12-7-3-4-8(9(14)6-7)11(17)13-5-1-2-10(15)16/h3-4,6,14H,1-2,5H2,(H,13,17)(H,15,16) |
| InChIKey | OVOXYVUXLMGTNB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|