4-[(2,4-dihydroxybenzoyl)amino]butanoic acid

C11H13NO5 — CID 16796144

IUPAC4-[(2,4-dihydroxybenzoyl)amino]butanoic acid
SMILESO=C(O)CCCNC(=O)c1ccc(O)cc1O
InChIInChI=1S/C11H13NO5/c13-7-3-4-8(9(14)6-7)11(17)12-5-1-2-10(15)16/h3-4,6,13-14H,1-2,5H2,(H,12,17)(H,15,16)
InChIKeyKFAMLNMQWISGSI-UHFFFAOYSA-N
MW239.23 g/mol
LogP0.69
Rot. Bonds5

About 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid

4-[(2,4-dihydroxybenzoyl)amino]butanoic acid (PubChem CID 16796144) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(2,4-dihydroxybenzoyl)amino]butanoic acid
PubChem CID16796144
Molecular FormulaC11H13NO5
Molecular Weight239.23 g/mol
Exact Mass239.08
IUPAC Name4-[(2,4-dihydroxybenzoyl)amino]butanoic acid
SMILESO=C(O)CCCNC(=O)c1ccc(O)cc1O
InChIInChI=1S/C11H13NO5/c13-7-3-4-8(9(14)6-7)11(17)12-5-1-2-10(15)16/h3-4,6,13-14H,1-2,5H2,(H,12,17)(H,15,16)
InChIKeyKFAMLNMQWISGSI-UHFFFAOYSA-N
XLogP0.69
TPSA106.86 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.23
LogP ≤ 50.69
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid?
The IUPAC name of 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid (CID 16796144) is 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid.
What is the SMILES notation for 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid?
The canonical SMILES for 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid is O=C(O)CCCNC(=O)c1ccc(O)cc1O.
What is the InChIKey of 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid?
The InChIKey is KFAMLNMQWISGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5/c13-7-3-4-8(9(14)6-7)11(17)12-5-1-2-10(15)16/h3-4,6,13-14H,1-2,5H2,(H,12,17)(H,15,16).
What are the key properties of 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid?
4-[(2,4-dihydroxybenzoyl)amino]butanoic acid has a molecular weight of 239.23 g/mol, XLogP of 0.69, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dihydroxybenzoyl)amino]butanoic acid is sourced from PubChem (CID 16796144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).