3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid

C11H13NO5 — CID 60989735

IUPAC3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid
SMILESCN(CCC(=O)O)C(=O)c1ccc(O)cc1O
InChIInChI=1S/C11H13NO5/c1-12(5-4-10(15)16)11(17)8-3-2-7(13)6-9(8)14/h2-3,6,13-14H,4-5H2,1H3,(H,15,16)
InChIKeyVVNRRSNOIBHKMD-UHFFFAOYSA-N
MW239.23 g/mol
LogP0.64
Rot. Bonds4

About 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid

3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid (PubChem CID 60989735) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid.

Molecular Properties

Compound Name3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid
PubChem CID60989735
Molecular FormulaC11H13NO5
Molecular Weight239.23 g/mol
Exact Mass239.08
IUPAC Name3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid
SMILESCN(CCC(=O)O)C(=O)c1ccc(O)cc1O
InChIInChI=1S/C11H13NO5/c1-12(5-4-10(15)16)11(17)8-3-2-7(13)6-9(8)14/h2-3,6,13-14H,4-5H2,1H3,(H,15,16)
InChIKeyVVNRRSNOIBHKMD-UHFFFAOYSA-N
XLogP0.64
TPSA98.07 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.23
LogP ≤ 50.64
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid?
The IUPAC name of 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid (CID 60989735) is 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid.
What is the SMILES notation for 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid?
The canonical SMILES for 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid is CN(CCC(=O)O)C(=O)c1ccc(O)cc1O.
What is the InChIKey of 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid?
The InChIKey is VVNRRSNOIBHKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5/c1-12(5-4-10(15)16)11(17)8-3-2-7(13)6-9(8)14/h2-3,6,13-14H,4-5H2,1H3,(H,15,16).
What are the key properties of 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid?
3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid has a molecular weight of 239.23 g/mol, XLogP of 0.64, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid is sourced from PubChem (CID 60989735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).