C11H13NO5 — CID 60989735
3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid (PubChem CID 60989735) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid.
| Compound Name | 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 60989735 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-[(2,4-dihydroxybenzoyl)-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H13NO5/c1-12(5-4-10(15)16)11(17)8-3-2-7(13)6-9(8)14/h2-3,6,13-14H,4-5H2,1H3,(H,15,16) |
| InChIKey | VVNRRSNOIBHKMD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |