C11H13NO5 — CID 43422761
methyl 2-[(2,4-dihydroxybenzoyl)-methylamino]acetate (PubChem CID 43422761) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is methyl 2-[(2,4-dihydroxybenzoyl)-methylamino]acetate.
| Compound Name | methyl 2-[(2,4-dihydroxybenzoyl)-methylamino]acetate |
|---|---|
| PubChem CID | 43422761 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | methyl 2-[(2,4-dihydroxybenzoyl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H13NO5/c1-12(6-10(15)17-2)11(16)8-4-3-7(13)5-9(8)14/h3-5,13-14H,6H2,1-2H3 |
| InChIKey | PRAQRGZJUUEMDE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |