C11H14N2O3S — CID 107722045
N-(3-amino-3-sulfanylidenepropyl)-2,4-dihydroxy-N-methylbenzamide (PubChem CID 107722045) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2,4-dihydroxy-N-methylbenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2,4-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107722045 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2,4-dihydroxy-N-methylbenzamide |
| SMILES | CN(CCC(N)=S)C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H14N2O3S/c1-13(5-4-10(12)17)11(16)8-3-2-7(14)6-9(8)15/h2-3,6,14-15H,4-5H2,1H3,(H2,12,17) |
| InChIKey | YTKNTSFHPABFQI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|