C14H19NO3 — CID 113347161
N-(cyclopentylmethyl)-2,4-dihydroxy-N-methylbenzamide (PubChem CID 113347161) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2,4-dihydroxy-N-methylbenzamide.
| Compound Name | N-(cyclopentylmethyl)-2,4-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 113347161 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(cyclopentylmethyl)-2,4-dihydroxy-N-methylbenzamide |
| SMILES | CN(CC1CCCC1)C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H19NO3/c1-15(9-10-4-2-3-5-10)14(18)12-7-6-11(16)8-13(12)17/h6-8,10,16-17H,2-5,9H2,1H3 |
| InChIKey | GGHLZUNXKMVAIU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |