C18H27NO4 — CID 44538835
8-[(2-hydroxy-4-propan-2-ylbenzoyl)amino]octanoic acid (PubChem CID 44538835) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 8-[(2-hydroxy-4-propan-2-ylbenzoyl)amino]octanoic acid.
| Compound Name | 8-[(2-hydroxy-4-propan-2-ylbenzoyl)amino]octanoic acid |
|---|---|
| PubChem CID | 44538835 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 8-[(2-hydroxy-4-propan-2-ylbenzoyl)amino]octanoic acid |
| SMILES | CC(C)c1ccc(C(=O)NCCCCCCCC(=O)O)c(O)c1 |
| InChI | InChI=1S/C18H27NO4/c1-13(2)14-9-10-15(16(20)12-14)18(23)19-11-7-5-3-4-6-8-17(21)22/h9-10,12-13,20H,3-8,11H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | ODCVBDRDWJLBSG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|