C14H16F3NO3 — CID 79757091
7-[(2,3,4-trifluorobenzoyl)amino]heptanoic acid (PubChem CID 79757091) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 7-[(2,3,4-trifluorobenzoyl)amino]heptanoic acid.
| Compound Name | 7-[(2,3,4-trifluorobenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 79757091 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 7-[(2,3,4-trifluorobenzoyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3NO3/c15-10-7-6-9(12(16)13(10)17)14(21)18-8-4-2-1-3-5-11(19)20/h6-7H,1-5,8H2,(H,18,21)(H,19,20) |
| InChIKey | TXPHZYOMCBBRPX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|