C9H7BrF3NO — CID 79749872
N-(2-bromoethyl)-2,3,4-trifluorobenzamide (PubChem CID 79749872) has the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(2-bromoethyl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 79749872 |
| Molecular Formula | C9H7BrF3NO |
| Molecular Weight | 282.06 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | N-(2-bromoethyl)-2,3,4-trifluorobenzamide |
| SMILES | O=C(NCCBr)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H7BrF3NO/c10-3-4-14-9(15)5-1-2-6(11)8(13)7(5)12/h1-2H,3-4H2,(H,14,15) |
| InChIKey | JAUCRANNWJIEKX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.06 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|