C14H9F4NO — CID 110755457
2,3,4-trifluoro-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 110755457) has the molecular formula C14H9F4NO and a molecular weight of 283.22 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 110755457 |
| Molecular Formula | C14H9F4NO |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9F4NO/c15-10-4-2-1-3-8(10)7-19-14(20)9-5-6-11(16)13(18)12(9)17/h1-6H,7H2,(H,19,20) |
| InChIKey | NLWSUYKCXFSZKH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|