C18H19F2NO — CID 175327917
3-butyl-2-fluoro-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 175327917) has the molecular formula C18H19F2NO and a molecular weight of 303.35 g/mol. Its IUPAC name is 3-butyl-2-fluoro-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | 3-butyl-2-fluoro-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 175327917 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-butyl-2-fluoro-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | CCCCc1cccc(C(=O)NCc2ccccc2F)c1F |
| InChI | InChI=1S/C18H19F2NO/c1-2-3-7-13-9-6-10-15(17(13)20)18(22)21-12-14-8-4-5-11-16(14)19/h4-6,8-11H,2-3,7,12H2,1H3,(H,21,22) |
| InChIKey | ALHVVLHICGANPI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |