C16H16FNO3 — CID 17068329
N-[(2-fluorophenyl)methyl]-2,3-dimethoxybenzamide (PubChem CID 17068329) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 17068329 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCc2ccccc2F)c1OC |
| InChI | InChI=1S/C16H16FNO3/c1-20-14-9-5-7-12(15(14)21-2)16(19)18-10-11-6-3-4-8-13(11)17/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | CYBCBEWZMFIALW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |