C15H13F2NO3 — CID 63373922
N-[(2,5-difluorophenyl)methyl]-2-hydroxy-3-methoxybenzamide (PubChem CID 63373922) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-hydroxy-3-methoxybenzamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 63373922 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCc2cc(F)ccc2F)c1O |
| InChI | InChI=1S/C15H13F2NO3/c1-21-13-4-2-3-11(14(13)19)15(20)18-8-9-7-10(16)5-6-12(9)17/h2-7,19H,8H2,1H3,(H,18,20) |
| InChIKey | ZGJUTMWRTKXDMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |