C21H25NO4 — CID 55810457
N-[(2-cyclopentyloxyphenyl)methyl]-2,3-dimethoxybenzamide (PubChem CID 55810457) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is N-[(2-cyclopentyloxyphenyl)methyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(2-cyclopentyloxyphenyl)methyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 55810457 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[(2-cyclopentyloxyphenyl)methyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCc2ccccc2OC2CCCC2)c1OC |
| InChI | InChI=1S/C21H25NO4/c1-24-19-13-7-11-17(20(19)25-2)21(23)22-14-15-8-3-6-12-18(15)26-16-9-4-5-10-16/h3,6-8,11-13,16H,4-5,9-10,14H2,1-2H3,(H,22,23) |
| InChIKey | JRYBBPXMEVELCU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |