C14H9BrF3NO — CID 62650266
N-[(5-bromo-2-fluorophenyl)methyl]-2,3-difluorobenzamide (PubChem CID 62650266) has the molecular formula C14H9BrF3NO and a molecular weight of 344.13 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2,3-difluorobenzamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62650266 |
| Molecular Formula | C14H9BrF3NO |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2,3-difluorobenzamide |
| SMILES | O=C(NCc1cc(Br)ccc1F)c1cccc(F)c1F |
| InChI | InChI=1S/C14H9BrF3NO/c15-9-4-5-11(16)8(6-9)7-19-14(20)10-2-1-3-12(17)13(10)18/h1-6H,7H2,(H,19,20) |
| InChIKey | IWSSVYPKSATIAX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |