C14H9Br2F2NO — CID 114372361
2,5-dibromo-N-[(2,5-difluorophenyl)methyl]benzamide (PubChem CID 114372361) has the molecular formula C14H9Br2F2NO and a molecular weight of 405.04 g/mol. Its IUPAC name is 2,5-dibromo-N-[(2,5-difluorophenyl)methyl]benzamide.
| Compound Name | 2,5-dibromo-N-[(2,5-difluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 114372361 |
| Molecular Formula | C14H9Br2F2NO |
| Molecular Weight | 405.04 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | 2,5-dibromo-N-[(2,5-difluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H9Br2F2NO/c15-9-1-3-12(16)11(6-9)14(20)19-7-8-5-10(17)2-4-13(8)18/h1-6H,7H2,(H,19,20) |
| InChIKey | GFHNFVQTQGZYIY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.04 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |