C14H10F4N2O — CID 63794966
2-amino-N-[(2,5-difluorophenyl)methyl]-4,5-difluorobenzamide (PubChem CID 63794966) has the molecular formula C14H10F4N2O and a molecular weight of 298.24 g/mol. Its IUPAC name is 2-amino-N-[(2,5-difluorophenyl)methyl]-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-[(2,5-difluorophenyl)methyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 63794966 |
| Molecular Formula | C14H10F4N2O |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-amino-N-[(2,5-difluorophenyl)methyl]-4,5-difluorobenzamide |
| SMILES | Nc1cc(F)c(F)cc1C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H10F4N2O/c15-8-1-2-10(16)7(3-8)6-20-14(21)9-4-11(17)12(18)5-13(9)19/h1-5H,6,19H2,(H,20,21) |
| InChIKey | WOYRIHFUGZAYAX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|