C12H12ClF3N2O2 — CID 108574420
N-[2-(3-chloropropanoylamino)ethyl]-2,3,4-trifluorobenzamide (PubChem CID 108574420) has the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.69 g/mol. Its IUPAC name is N-[2-(3-chloropropanoylamino)ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(3-chloropropanoylamino)ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108574420 |
| Molecular Formula | C12H12ClF3N2O2 |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-[2-(3-chloropropanoylamino)ethyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(CCCl)NCCNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H12ClF3N2O2/c13-4-3-9(19)17-5-6-18-12(20)7-1-2-8(14)11(16)10(7)15/h1-2H,3-6H2,(H,17,19)(H,18,20) |
| InChIKey | NEGUMURWNGCFRF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|