C12H13ClF3NO2 — CID 114171307
N-[3-(2-chloroethoxy)propyl]-2,3,4-trifluorobenzamide (PubChem CID 114171307) has the molecular formula C12H13ClF3NO2 and a molecular weight of 295.69 g/mol. Its IUPAC name is N-[3-(2-chloroethoxy)propyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[3-(2-chloroethoxy)propyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 114171307 |
| Molecular Formula | C12H13ClF3NO2 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-[3-(2-chloroethoxy)propyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(NCCCOCCCl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H13ClF3NO2/c13-4-7-19-6-1-5-17-12(18)8-2-3-9(14)11(16)10(8)15/h2-3H,1,4-7H2,(H,17,18) |
| InChIKey | UNXNEFUIRSQYIP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|