C20H22FNO3 — CID 119220141
6-[[2-fluoro-4-(4-methylphenyl)benzoyl]amino]hexanoic acid (PubChem CID 119220141) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 6-[[2-fluoro-4-(4-methylphenyl)benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[2-fluoro-4-(4-methylphenyl)benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220141 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 6-[[2-fluoro-4-(4-methylphenyl)benzoyl]amino]hexanoic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)NCCCCCC(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C20H22FNO3/c1-14-6-8-15(9-7-14)16-10-11-17(18(21)13-16)20(25)22-12-4-2-3-5-19(23)24/h6-11,13H,2-5,12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | CKXLRXFSOSPETG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|