C20H26FN3O8 — CID 145069075
2-[[(1S)-1-carboxy-5-[(2-fluoro-4-methylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 145069075) has the molecular formula C20H26FN3O8 and a molecular weight of 455.44 g/mol. Its IUPAC name is 2-[[(1S)-1-carboxy-5-[(2-fluoro-4-methylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[(1S)-1-carboxy-5-[(2-fluoro-4-methylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 145069075 |
| Molecular Formula | C20H26FN3O8 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[[(1S)-1-carboxy-5-[(2-fluoro-4-methylbenzoyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | Cc1ccc(C(=O)NCCCC[C@H](NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H26FN3O8/c1-11-5-6-12(13(21)10-11)17(27)22-9-3-2-4-14(18(28)29)23-20(32)24-15(19(30)31)7-8-16(25)26/h5-6,10,14-15H,2-4,7-9H2,1H3,(H,22,27)(H,25,26)(H,28,29)(H,30,31)(H2,23,24,32)/t14-,15?/m0/s1 |
| InChIKey | IMIWZSBBAYYFPB-MLCCFXAWSA-N |
| XLogP | 1.10 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|