C20H29N3O7 — CID 76666938
2-[[1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 76666938) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[[1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 76666938 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[[1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | Cc1ccc(CNCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H29N3O7/c1-13-5-7-14(8-6-13)12-21-11-3-2-4-15(18(26)27)22-20(30)23-16(19(28)29)9-10-17(24)25/h5-8,15-16,21H,2-4,9-12H2,1H3,(H,24,25)(H,26,27)(H,28,29)(H2,22,23,30) |
| InChIKey | QVCIAJIVVHNMGF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|