C15H27N3O7 — CID 130425498
(2R)-2-[[(1S)-1-carboxy-5-(propan-2-ylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 130425498) has the molecular formula C15H27N3O7 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-carboxy-5-(propan-2-ylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2R)-2-[[(1S)-1-carboxy-5-(propan-2-ylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 130425498 |
| Molecular Formula | C15H27N3O7 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2R)-2-[[(1S)-1-carboxy-5-(propan-2-ylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(C)NCCCC[C@H](NC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27N3O7/c1-9(2)16-8-4-3-5-10(13(21)22)17-15(25)18-11(14(23)24)6-7-12(19)20/h9-11,16H,3-8H2,1-2H3,(H,19,20)(H,21,22)(H,23,24)(H2,17,18,25)/t10-,11+/m0/s1 |
| InChIKey | BIXRSMSPBBUYDA-WDEREUQCSA-N |
| XLogP | 0.23 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|