C12H20N2O7 — CID 88542905
2-[[(1S)-1-carboxy-3-methylbutyl]carbamoylamino]pentanedioic acid (PubChem CID 88542905) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[[(1S)-1-carboxy-3-methylbutyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[(1S)-1-carboxy-3-methylbutyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 88542905 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[[(1S)-1-carboxy-3-methylbutyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(C)C[C@H](NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N2O7/c1-6(2)5-8(11(19)20)14-12(21)13-7(10(17)18)3-4-9(15)16/h6-8H,3-5H2,1-2H3,(H,15,16)(H,17,18)(H,19,20)(H2,13,14,21)/t7?,8-/m0/s1 |
| InChIKey | BSGWCSGMXAVYRT-MQWKRIRWSA-N |
| XLogP | 0.10 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |