C10H16N2O7S — CID 59768729
(2S)-2-[[(1R)-1-carboxy-2-(111C)methylsulfanylethyl]carbamoylamino]pentanedioic acid (PubChem CID 59768729) has the molecular formula C10H16N2O7S and a molecular weight of 307.31 g/mol. Its IUPAC name is (2S)-2-[[(1R)-1-carboxy-2-(111C)methylsulfanylethyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1R)-1-carboxy-2-(111C)methylsulfanylethyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 59768729 |
| Molecular Formula | C10H16N2O7S |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (2S)-2-[[(1R)-1-carboxy-2-(111C)methylsulfanylethyl]carbamoylamino]pentanedioic acid |
| SMILES | [11CH3]SC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7S/c1-20-4-6(9(17)18)12-10(19)11-5(8(15)16)2-3-7(13)14/h5-6H,2-4H2,1H3,(H,13,14)(H,15,16)(H,17,18)(H2,11,12,19)/t5-,6-/m0/s1/i1-1 |
| InChIKey | AUSWZMPQDDVDBG-WNXVLKGOSA-N |
| XLogP | -0.58 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |