C11H20N2O5S — CID 113495071
(2S)-2-(1-methylsulfanylbutan-2-ylcarbamoylamino)pentanedioic acid (PubChem CID 113495071) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is (2S)-2-(1-methylsulfanylbutan-2-ylcarbamoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(1-methylsulfanylbutan-2-ylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 113495071 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2S)-2-(1-methylsulfanylbutan-2-ylcarbamoylamino)pentanedioic acid |
| SMILES | CCC(CSC)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5S/c1-3-7(6-19-2)12-11(18)13-8(10(16)17)4-5-9(14)15/h7-8H,3-6H2,1-2H3,(H,14,15)(H,16,17)(H2,12,13,18)/t7?,8-/m0/s1 |
| InChIKey | JMRLMNCMWZDBCI-MQWKRIRWSA-N |
| XLogP | 0.75 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |