C14H22N2O10 — CID 161394708
(2R)-2-acetamidopentanedioic acid (PubChem CID 161394708) has the molecular formula C14H22N2O10 and a molecular weight of 378.33 g/mol. Its IUPAC name is (2R)-2-acetamidopentanedioic acid.
| Compound Name | (2R)-2-acetamidopentanedioic acid |
|---|---|
| PubChem CID | 161394708 |
| Molecular Formula | C14H22N2O10 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2R)-2-acetamidopentanedioic acid |
| SMILES | CC(=O)N[C@H](CCC(=O)O)C(=O)O.CC(=O)N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/2C7H11NO5/c2*1-4(9)8-5(7(12)13)2-3-6(10)11/h2*5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t2*5-/m11/s1 |
| InChIKey | VTLHIMALJRMRQM-BXXIVHCWSA-N |
| XLogP | -1.12 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |