C7H12NNaO5 — CID 174759802
sodium;(2S)-2-acetamidopentanedioic acid;hydride (PubChem CID 174759802) has the molecular formula C7H12NNaO5 and a molecular weight of 213.16 g/mol. Its IUPAC name is sodium;(2S)-2-acetamidopentanedioic acid;hydride.
| Compound Name | sodium;(2S)-2-acetamidopentanedioic acid;hydride |
|---|---|
| PubChem CID | 174759802 |
| Molecular Formula | C7H12NNaO5 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | sodium;(2S)-2-acetamidopentanedioic acid;hydride |
| SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H11NO5.Na.H/c1-4(9)8-5(7(12)13)2-3-6(10)11;;/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13);;/q;+1;-1/t5-;;/m0../s1 |
| InChIKey | GCCGQUNWUWHOAM-XRIGFGBMSA-N |
| XLogP | -3.44 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |