C27H48N6O12 — CID 158833796
2-acetamido-5-(ethylamino)-5-oxopentanoic acid (PubChem CID 158833796) has the molecular formula C27H48N6O12 and a molecular weight of 648.71 g/mol. Its IUPAC name is 2-acetamido-5-(ethylamino)-5-oxopentanoic acid.
| Compound Name | 2-acetamido-5-(ethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 158833796 |
| Molecular Formula | C27H48N6O12 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | 2-acetamido-5-(ethylamino)-5-oxopentanoic acid |
| SMILES | CCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/3C9H16N2O4/c3*1-3-10-8(13)5-4-7(9(14)15)11-6(2)12/h3*7H,3-5H2,1-2H3,(H,10,13)(H,11,12)(H,14,15) |
| InChIKey | IXJJZMYAXJJOPB-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 286.50 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |