2-acetamido-5-(ethylamino)-5-oxopentanoic acid

C27H48N6O12 — CID 158833796

IUPAC2-acetamido-5-(ethylamino)-5-oxopentanoic acid
SMILESCCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O
InChIInChI=1S/3C9H16N2O4/c3*1-3-10-8(13)5-4-7(9(14)15)11-6(2)12/h3*7H,3-5H2,1-2H3,(H,10,13)(H,11,12)(H,14,15)
InChIKeyIXJJZMYAXJJOPB-UHFFFAOYSA-N
MW648.71 g/mol
LogP-1.52
Rot. Bonds18

About 2-acetamido-5-(ethylamino)-5-oxopentanoic acid

2-acetamido-5-(ethylamino)-5-oxopentanoic acid (PubChem CID 158833796) has the molecular formula C27H48N6O12 and a molecular weight of 648.71 g/mol. Its IUPAC name is 2-acetamido-5-(ethylamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name2-acetamido-5-(ethylamino)-5-oxopentanoic acid
PubChem CID158833796
Molecular FormulaC27H48N6O12
Molecular Weight648.71 g/mol
Exact Mass648.33
IUPAC Name2-acetamido-5-(ethylamino)-5-oxopentanoic acid
SMILESCCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O
InChIInChI=1S/3C9H16N2O4/c3*1-3-10-8(13)5-4-7(9(14)15)11-6(2)12/h3*7H,3-5H2,1-2H3,(H,10,13)(H,11,12)(H,14,15)
InChIKeyIXJJZMYAXJJOPB-UHFFFAOYSA-N
XLogP-1.52
TPSA286.50 Ų
H-Bond Donors9
H-Bond Acceptors9
Rotatable Bonds18
Heavy Atoms45
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500648.71
LogP ≤ 5-1.52
H-Bond Donors ≤ 59
H-Bond Acceptors ≤ 109

Analyze 2-acetamido-5-(ethylamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-5-(ethylamino)-5-oxopentanoic acid?
The IUPAC name of 2-acetamido-5-(ethylamino)-5-oxopentanoic acid (CID 158833796) is 2-acetamido-5-(ethylamino)-5-oxopentanoic acid.
What is the SMILES notation for 2-acetamido-5-(ethylamino)-5-oxopentanoic acid?
The canonical SMILES for 2-acetamido-5-(ethylamino)-5-oxopentanoic acid is CCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O.CCNC(=O)CCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamido-5-(ethylamino)-5-oxopentanoic acid?
The InChIKey is IXJJZMYAXJJOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/3C9H16N2O4/c3*1-3-10-8(13)5-4-7(9(14)15)11-6(2)12/h3*7H,3-5H2,1-2H3,(H,10,13)(H,11,12)(H,14,15).
What are the key properties of 2-acetamido-5-(ethylamino)-5-oxopentanoic acid?
2-acetamido-5-(ethylamino)-5-oxopentanoic acid has a molecular weight of 648.71 g/mol, XLogP of -1.52, 18 rotatable bonds, 9 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-5-(ethylamino)-5-oxopentanoic acid is sourced from PubChem (CID 158833796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).