C13H23N3O6 — CID 167256422
(2S)-6-[[(4S)-4-acetamido-4-carboxybutanoyl]amino]-2-aminohexanoic acid (PubChem CID 167256422) has the molecular formula C13H23N3O6 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2S)-6-[[(4S)-4-acetamido-4-carboxybutanoyl]amino]-2-aminohexanoic acid.
| Compound Name | (2S)-6-[[(4S)-4-acetamido-4-carboxybutanoyl]amino]-2-aminohexanoic acid |
|---|---|
| PubChem CID | 167256422 |
| Molecular Formula | C13H23N3O6 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2S)-6-[[(4S)-4-acetamido-4-carboxybutanoyl]amino]-2-aminohexanoic acid |
| SMILES | CC(=O)N[C@@H](CCC(=O)NCCCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23N3O6/c1-8(17)16-10(13(21)22)5-6-11(18)15-7-3-2-4-9(14)12(19)20/h9-10H,2-7,14H2,1H3,(H,15,18)(H,16,17)(H,19,20)(H,21,22)/t9-,10-/m0/s1 |
| InChIKey | FXJYNWHXLXWZNI-UWVGGRQHSA-N |
| XLogP | -0.95 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|