C28H44FN7O14 — CID 123451623
2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-[(6-fluoro-5-hydrazinyl-6-oxohexyl)amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid (PubChem CID 123451623) has the molecular formula C28H44FN7O14 and a molecular weight of 721.69 g/mol. Its IUPAC name is 2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-[(6-fluoro-5-hydrazinyl-6-oxohexyl)amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-[(6-fluoro-5-hydrazinyl-6-oxohexyl)amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123451623 |
| Molecular Formula | C28H44FN7O14 |
| Molecular Weight | 721.69 g/mol |
| Exact Mass | 721.29 |
| IUPAC Name | 2-acetamido-5-[[1-carboxy-4-[[1-carboxy-4-[[1-carboxy-4-[(6-fluoro-5-hydrazinyl-6-oxohexyl)amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)NC(CCC(=O)NC(CCC(=O)NC(CCC(=O)NC(CCC(=O)NCCCCC(NN)C(=O)F)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C28H44FN7O14/c1-14(37)32-16(25(43)44)6-10-21(39)34-18(27(47)48)8-12-23(41)35-19(28(49)50)7-11-22(40)33-17(26(45)46)5-9-20(38)31-13-3-2-4-15(36-30)24(29)42/h15-19,36H,2-13,30H2,1H3,(H,31,38)(H,32,37)(H,33,40)(H,34,39)(H,35,41)(H,43,44)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | GNFDCUKTEUMQLC-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 349.82 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.69 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|