C12H22N2O4S2 — CID 89167992
2,6-bis(3-sulfanylpropanoylamino)hexanoic acid (PubChem CID 89167992) has the molecular formula C12H22N2O4S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2,6-bis(3-sulfanylpropanoylamino)hexanoic acid.
| Compound Name | 2,6-bis(3-sulfanylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 89167992 |
| Molecular Formula | C12H22N2O4S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2,6-bis(3-sulfanylpropanoylamino)hexanoic acid |
| SMILES | O=C(CCS)NCCCCC(NC(=O)CCS)C(=O)O |
| InChI | InChI=1S/C12H22N2O4S2/c15-10(4-7-19)13-6-2-1-3-9(12(17)18)14-11(16)5-8-20/h9,19-20H,1-8H2,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | QZSWQZMBVQJPRZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|