C16H22N2O8 — CID 169121656
2,6-bis(3-carboxybut-3-enoylamino)hexanoic acid (PubChem CID 169121656) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2,6-bis(3-carboxybut-3-enoylamino)hexanoic acid.
| Compound Name | 2,6-bis(3-carboxybut-3-enoylamino)hexanoic acid |
|---|---|
| PubChem CID | 169121656 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2,6-bis(3-carboxybut-3-enoylamino)hexanoic acid |
| SMILES | C=C(CC(=O)NCCCCC(NC(=O)CC(=C)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22N2O8/c1-9(14(21)22)7-12(19)17-6-4-3-5-11(16(25)26)18-13(20)8-10(2)15(23)24/h11H,1-8H2,(H,17,19)(H,18,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | PUXZIMVUVGNCNT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|