C10H18N2O6 — CID 124780506
(2R)-2,6-bis[(2-hydroxyacetyl)amino]hexanoic acid (PubChem CID 124780506) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is (2R)-2,6-bis[(2-hydroxyacetyl)amino]hexanoic acid.
| Compound Name | (2R)-2,6-bis[(2-hydroxyacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 124780506 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2R)-2,6-bis[(2-hydroxyacetyl)amino]hexanoic acid |
| SMILES | O=C(CO)NCCCC[C@@H](NC(=O)CO)C(=O)O |
| InChI | InChI=1S/C10H18N2O6/c13-5-8(15)11-4-2-1-3-7(10(17)18)12-9(16)6-14/h7,13-14H,1-6H2,(H,11,15)(H,12,16)(H,17,18)/t7-/m1/s1 |
| InChIKey | LJYZYSYXZUDTMF-SSDOTTSWSA-N |
| XLogP | -2.17 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|