C11H23NO2 — CID 134467211
2-hydroxy-N-(7-methyloctyl)acetamide (PubChem CID 134467211) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-hydroxy-N-(7-methyloctyl)acetamide.
| Compound Name | 2-hydroxy-N-(7-methyloctyl)acetamide |
|---|---|
| PubChem CID | 134467211 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-hydroxy-N-(7-methyloctyl)acetamide |
| SMILES | CC(C)CCCCCCNC(=O)CO |
| InChI | InChI=1S/C11H23NO2/c1-10(2)7-5-3-4-6-8-12-11(14)9-13/h10,13H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | PLUPRSAFUCWVJK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|