C14H29NO — CID 129055781
4-methyl-N-(6-methylheptyl)pentanamide (PubChem CID 129055781) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 4-methyl-N-(6-methylheptyl)pentanamide.
| Compound Name | 4-methyl-N-(6-methylheptyl)pentanamide |
|---|---|
| PubChem CID | 129055781 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 4-methyl-N-(6-methylheptyl)pentanamide |
| SMILES | CC(C)CCCCCNC(=O)CCC(C)C |
| InChI | InChI=1S/C14H29NO/c1-12(2)8-6-5-7-11-15-14(16)10-9-13(3)4/h12-13H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | BIYUQUVQAAGQKX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|