C13H27NO — CID 154028337
N-butyl-7-methyloctanamide (PubChem CID 154028337) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-butyl-7-methyloctanamide.
| Compound Name | N-butyl-7-methyloctanamide |
|---|---|
| PubChem CID | 154028337 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-butyl-7-methyloctanamide |
| SMILES | CCCCNC(=O)CCCCCC(C)C |
| InChI | InChI=1S/C13H27NO/c1-4-5-11-14-13(15)10-8-6-7-9-12(2)3/h12H,4-11H2,1-3H3,(H,14,15) |
| InChIKey | GCCUAZSPYBQNNI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|