C32H66N10O4 — CID 59921848
(2S)-2,6-bis[[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]hexanoic acid (PubChem CID 59921848) has the molecular formula C32H66N10O4 and a molecular weight of 654.95 g/mol. Its IUPAC name is (2S)-2,6-bis[[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2,6-bis[[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59921848 |
| Molecular Formula | C32H66N10O4 |
| Molecular Weight | 654.95 g/mol |
| Exact Mass | 654.53 |
| IUPAC Name | (2S)-2,6-bis[[2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]hexanoic acid |
| SMILES | CN1CCN(C)CCN(CC(=O)NCCCC[C@H](NC(=O)CN2CCN(C)CCN(C)CCN(C)CC2)C(=O)O)CCN(C)CC1 |
| InChI | InChI=1S/C32H66N10O4/c1-35-11-15-37(3)19-23-41(24-20-38(4)16-12-35)27-30(43)33-10-8-7-9-29(32(45)46)34-31(44)28-42-25-21-39(5)17-13-36(2)14-18-40(6)22-26-42/h29H,7-28H2,1-6H3,(H,33,43)(H,34,44)(H,45,46)/t29-/m0/s1 |
| InChIKey | AGKJOZSXXWLFLL-LJAQVGFWSA-N |
| XLogP | -1.94 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.95 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|