C19H44N8O2 — CID 157343011
bis(N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide);methane (PubChem CID 157343011) has the molecular formula C19H44N8O2 and a molecular weight of 416.62 g/mol. Its IUPAC name is bis(N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide);methane.
| Compound Name | bis(N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide);methane |
|---|---|
| PubChem CID | 157343011 |
| Molecular Formula | C19H44N8O2 |
| Molecular Weight | 416.62 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | bis(N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide);methane |
| SMILES | C.CN1CCN(CC(=O)NCCN)CC1.CN1CCN(CC(=O)NCCN)CC1 |
| InChI | InChI=1S/2C9H20N4O.CH4/c2*1-12-4-6-13(7-5-12)8-9(14)11-3-2-10;/h2*2-8,10H2,1H3,(H,11,14);1H4 |
| InChIKey | BGPVKHMCMPXOHH-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.62 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |