C28H60N12O4 — CID 101418883
N-(3-aminopropyl)-2-[4,7,10-tris[2-(3-aminopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 101418883) has the molecular formula C28H60N12O4 and a molecular weight of 628.87 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[4,7,10-tris[2-(3-aminopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | N-(3-aminopropyl)-2-[4,7,10-tris[2-(3-aminopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 101418883 |
| Molecular Formula | C28H60N12O4 |
| Molecular Weight | 628.87 g/mol |
| Exact Mass | 628.49 |
| IUPAC Name | N-(3-aminopropyl)-2-[4,7,10-tris[2-(3-aminopropylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | NCCCNC(=O)CN1CCN(CC(=O)NCCCN)CCN(CC(=O)NCCCN)CCN(CC(=O)NCCCN)CC1 |
| InChI | InChI=1S/C28H60N12O4/c29-5-1-9-33-25(41)21-37-13-15-38(22-26(42)34-10-2-6-30)17-19-40(24-28(44)36-12-4-8-32)20-18-39(16-14-37)23-27(43)35-11-3-7-31/h1-24,29-32H2,(H,33,41)(H,34,42)(H,35,43)(H,36,44) |
| InChIKey | SMYCJYXIQVTDRQ-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 233.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.87 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|