C40H72N8O12 — CID 122205584
6-[[2-[4,7,10-tris[2-(5-carboxypentylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid (PubChem CID 122205584) has the molecular formula C40H72N8O12 and a molecular weight of 857.06 g/mol. Its IUPAC name is 6-[[2-[4,7,10-tris[2-(5-carboxypentylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[4,7,10-tris[2-(5-carboxypentylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 122205584 |
| Molecular Formula | C40H72N8O12 |
| Molecular Weight | 857.06 g/mol |
| Exact Mass | 856.53 |
| IUPAC Name | 6-[[2-[4,7,10-tris[2-(5-carboxypentylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CN1CCN(CC(=O)NCCCCCC(=O)O)CCN(CC(=O)NCCCCCC(=O)O)CCN(CC(=O)NCCCCCC(=O)O)CC1 |
| InChI | InChI=1S/C40H72N8O12/c49-33(41-17-9-1-5-13-37(53)54)29-45-21-23-46(30-34(50)42-18-10-2-6-14-38(55)56)25-27-48(32-36(52)44-20-12-4-8-16-40(59)60)28-26-47(24-22-45)31-35(51)43-19-11-3-7-15-39(57)58/h1-32H2,(H,41,49)(H,42,50)(H,43,51)(H,44,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | XFIKQMFNVDQSFB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 278.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.06 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|