C21H38N6O9 — CID 177035728
(2S)-2-amino-5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoic acid (PubChem CID 177035728) has the molecular formula C21H38N6O9 and a molecular weight of 518.57 g/mol. Its IUPAC name is (2S)-2-amino-5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 177035728 |
| Molecular Formula | C21H38N6O9 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (2S)-2-amino-5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoic acid |
| SMILES | N[C@@H](CCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C21H38N6O9/c22-16(21(35)36)2-1-3-23-17(28)12-24-4-6-25(13-18(29)30)8-10-27(15-20(33)34)11-9-26(7-5-24)14-19(31)32/h16H,1-15,22H2,(H,23,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)/t16-/m0/s1 |
| InChIKey | FYUAFOSXDMZARJ-INIZCTEOSA-N |
| XLogP | -3.23 |
| TPSA | 217.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|