C18H34N4O5 — CID 155715635
2-[4-(carboxymethyl)-7-[2-(4-methylpentylamino)-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 155715635) has the molecular formula C18H34N4O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-[2-(4-methylpentylamino)-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-[2-(4-methylpentylamino)-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 155715635 |
| Molecular Formula | C18H34N4O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-[2-(4-methylpentylamino)-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CC(C)CCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H34N4O5/c1-15(2)4-3-5-19-16(23)12-20-6-8-21(13-17(24)25)10-11-22(9-7-20)14-18(26)27/h15H,3-14H2,1-2H3,(H,19,23)(H,24,25)(H,26,27) |
| InChIKey | DJBVCNOACOAXDU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|