C28H47N7O9 — CID 171757938
2-[4,7-bis(carboxymethyl)-10-[2-[2-[[2-(4-methylpentylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171757938) has the molecular formula C28H47N7O9 and a molecular weight of 625.72 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[2-[[2-(4-methylpentylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[2-[[2-(4-methylpentylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171757938 |
| Molecular Formula | C28H47N7O9 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[2-[[2-(4-methylpentylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)CCCNc1c(NCCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(=O)c1=O |
| InChI | InChI=1S/C28H47N7O9/c1-20(2)4-3-5-30-25-26(28(44)27(25)43)31-7-6-29-21(36)16-32-8-10-33(17-22(37)38)12-14-35(19-24(41)42)15-13-34(11-9-32)18-23(39)40/h20,30-31H,3-19H2,1-2H3,(H,29,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | WZRGEBXETZFXLL-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 212.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|