C31H55N9O9 — CID 171639492
2-[7-[[[3-amino-1-[2-[[2-(5-methylhexylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-1-oxopropan-2-yl]amino]methyl]-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171639492) has the molecular formula C31H55N9O9 and a molecular weight of 697.84 g/mol. Its IUPAC name is 2-[7-[[[3-amino-1-[2-[[2-(5-methylhexylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-1-oxopropan-2-yl]amino]methyl]-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-[[[3-amino-1-[2-[[2-(5-methylhexylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-1-oxopropan-2-yl]amino]methyl]-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171639492 |
| Molecular Formula | C31H55N9O9 |
| Molecular Weight | 697.84 g/mol |
| Exact Mass | 697.41 |
| IUPAC Name | 2-[7-[[[3-amino-1-[2-[[2-(5-methylhexylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-1-oxopropan-2-yl]amino]methyl]-4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)CCCCNc1c(NCCNC(=O)C(CN)NCN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(=O)c1=O |
| InChI | InChI=1S/C31H55N9O9/c1-22(2)5-3-4-6-33-27-28(30(48)29(27)47)34-7-8-35-31(49)23(17-32)36-21-40-15-13-38(19-25(43)44)11-9-37(18-24(41)42)10-12-39(14-16-40)20-26(45)46/h22-23,33-34,36H,3-21,32H2,1-2H3,(H,35,49)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | VCTCJBBLBLRNGQ-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 250.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.84 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|