C26H50N8O8 — CID 175614418
2-[4,10-bis(carboxymethyl)-7-[[[3-[2-(5-methylhexylcarbamoyl)hydrazinyl]-3-oxopropyl]amino]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 175614418) has the molecular formula C26H50N8O8 and a molecular weight of 602.73 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-[[[3-[2-(5-methylhexylcarbamoyl)hydrazinyl]-3-oxopropyl]amino]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-[[[3-[2-(5-methylhexylcarbamoyl)hydrazinyl]-3-oxopropyl]amino]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 175614418 |
| Molecular Formula | C26H50N8O8 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-[[[3-[2-(5-methylhexylcarbamoyl)hydrazinyl]-3-oxopropyl]amino]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)CCCCNC(=O)NNC(=O)CCNCN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C26H50N8O8/c1-21(2)5-3-4-7-28-26(42)30-29-22(35)6-8-27-20-34-15-13-32(18-24(38)39)11-9-31(17-23(36)37)10-12-33(14-16-34)19-25(40)41/h21,27H,3-20H2,1-2H3,(H,29,35)(H,36,37)(H,38,39)(H,40,41)(H2,28,30,42) |
| InChIKey | HHGHLXLTGWYUTP-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 207.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|