C27H45N7O10 — CID 175614422
2-[4,7-bis(carboxymethyl)-10-[2-[2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]ethoxyamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 175614422) has the molecular formula C27H45N7O10 and a molecular weight of 627.70 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]ethoxyamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]ethoxyamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 175614422 |
| Molecular Formula | C27H45N7O10 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]ethoxyamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCCNc1c(NCCONC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(=O)c1=O |
| InChI | InChI=1S/C27H45N7O10/c1-2-3-4-5-28-24-25(27(43)26(24)42)29-6-15-44-30-20(35)16-31-7-9-32(17-21(36)37)11-13-34(19-23(40)41)14-12-33(10-8-31)18-22(38)39/h28-29H,2-19H2,1H3,(H,30,35)(H,36,37)(H,38,39)(H,40,41) |
| InChIKey | FNCKBMRNKQYNIA-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 221.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|