C31H55N7O9 — CID 171639555
2-[4-(carboxymethyl)-10-ethyl-7-[2-[2-[[2-(5-methylheptylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid (PubChem CID 171639555) has the molecular formula C31H55N7O9 and a molecular weight of 669.82 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-10-ethyl-7-[2-[2-[[2-(5-methylheptylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid.
| Compound Name | 2-[4-(carboxymethyl)-10-ethyl-7-[2-[2-[[2-(5-methylheptylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid |
|---|---|
| PubChem CID | 171639555 |
| Molecular Formula | C31H55N7O9 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.41 |
| IUPAC Name | 2-[4-(carboxymethyl)-10-ethyl-7-[2-[2-[[2-(5-methylheptylamino)-3,4-dioxocyclobuten-1-yl]amino]ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;formic acid |
| SMILES | CCC(C)CCCCNc1c(NCCNC(=O)CN2CCN(CC)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(=O)c1=O.O=CO |
| InChI | InChI=1S/C30H53N7O7.CH2O2/c1-4-23(3)8-6-7-9-32-27-28(30(44)29(27)43)33-11-10-31-24(38)20-35-14-12-34(5-2)13-15-36(21-25(39)40)18-19-37(17-16-35)22-26(41)42;2-1-3/h23,32-33H,4-22H2,1-3H3,(H,31,38)(H,39,40)(H,41,42);1H,(H,2,3) |
| InChIKey | QIVDMSFMRQKCSG-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 212.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|