C20H37N5O8 — CID 171507810
2-[4,7-bis(carboxymethyl)-10-[2-(2-methylpropoxyamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171507810) has the molecular formula C20H37N5O8 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-(2-methylpropoxyamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-(2-methylpropoxyamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171507810 |
| Molecular Formula | C20H37N5O8 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-(2-methylpropoxyamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)CONC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H37N5O8/c1-16(2)15-33-21-17(26)11-22-3-5-23(12-18(27)28)7-9-25(14-20(31)32)10-8-24(6-4-22)13-19(29)30/h16H,3-15H2,1-2H3,(H,21,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | YROLUKZGLDZIKX-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|