copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid

C12H21CuN3O6+2 — CID 6398176

IUPACcopper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid
SMILESO=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1.[Cu+2]
InChIInChI=1S/C12H21N3O6.Cu/c16-10(17)7-13-1-2-14(8-11(18)19)5-6-15(4-3-13)9-12(20)21;/h1-9H2,(H,16,17)(H,18,19)(H,20,21);/q;+2
InChIKeyFNZVDZAUBJUPLO-UHFFFAOYSA-N
MW366.86 g/mol
LogP-1.84
Rot. Bonds6

About copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid

copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 6398176) has the molecular formula C12H21CuN3O6+2 and a molecular weight of 366.86 g/mol. Its IUPAC name is copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.

Molecular Properties

Compound Namecopper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid
PubChem CID6398176
Molecular FormulaC12H21CuN3O6+2
Molecular Weight366.86 g/mol
Exact Mass366.07
IUPAC Namecopper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid
SMILESO=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1.[Cu+2]
InChIInChI=1S/C12H21N3O6.Cu/c16-10(17)7-13-1-2-14(8-11(18)19)5-6-15(4-3-13)9-12(20)21;/h1-9H2,(H,16,17)(H,18,19)(H,20,21);/q;+2
InChIKeyFNZVDZAUBJUPLO-UHFFFAOYSA-N
XLogP-1.84
TPSA121.62 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.86
LogP ≤ 5-1.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
The IUPAC name of copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (CID 6398176) is copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
What is the SMILES notation for copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
The canonical SMILES for copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid is O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1.[Cu+2].
What is the InChIKey of copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
The InChIKey is FNZVDZAUBJUPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O6.Cu/c16-10(17)7-13-1-2-14(8-11(18)19)5-6-15(4-3-13)9-12(20)21;/h1-9H2,(H,16,17)(H,18,19)(H,20,21);/q;+2.
What are the key properties of copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid?
copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid has a molecular weight of 366.86 g/mol, XLogP of -1.84, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid is sourced from PubChem (CID 6398176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).