C12H21CuN3O6+2 — CID 6398176
copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 6398176) has the molecular formula C12H21CuN3O6+2 and a molecular weight of 366.86 g/mol. Its IUPAC name is copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 6398176 |
| Molecular Formula | C12H21CuN3O6+2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | copper 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1.[Cu+2] |
| InChI | InChI=1S/C12H21N3O6.Cu/c16-10(17)7-13-1-2-14(8-11(18)19)5-6-15(4-3-13)9-12(20)21;/h1-9H2,(H,16,17)(H,18,19)(H,20,21);/q;+2 |
| InChIKey | FNZVDZAUBJUPLO-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |